C32H34FN7O2 — CID 78079014
2-[2-[[4-amino-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(dimethylamino)-4-methylpent-2-enenitrile (PubChem CID 78079014) has the molecular formula C32H34FN7O2 and a molecular weight of 567.67 g/mol. Its IUPAC name is 2-[2-[[4-amino-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(dimethylamino)-4-methylpent-2-enenitrile.
| Compound Name | 2-[2-[[4-amino-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(dimethylamino)-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 78079014 |
| Molecular Formula | C32H34FN7O2 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 2-[2-[[4-amino-5-(2-fluoro-4-phenoxyphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]pyrrolidine-1-carbonyl]-4-(dimethylamino)-4-methylpent-2-enenitrile |
| SMILES | CN(C)C(C)(C)C=C(C#N)C(=O)N1CCCC1Cn1cc(-c2ccc(Oc3ccccc3)cc2F)c2c(N)ncnc21 |
| InChI | InChI=1S/C32H34FN7O2/c1-32(2,38(3)4)16-21(17-34)31(41)40-14-8-9-22(40)18-39-19-26(28-29(35)36-20-37-30(28)39)25-13-12-24(15-27(25)33)42-23-10-6-5-7-11-23/h5-7,10-13,15-16,19-20,22H,8-9,14,18H2,1-4H3,(H2,35,36,37) |
| InChIKey | OGWLOAWKWZUJRA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|