C19H22N4O3S — CID 78082416
(1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(5-methylpyrazin-2-yl)methanone (PubChem CID 78082416) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is (1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(5-methylpyrazin-2-yl)methanone.
| Compound Name | (1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 78082416 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (1-benzyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(5-methylpyrazin-2-yl)methanone |
| SMILES | Cc1cnc(C(=O)N2CCN(Cc3ccccc3)C3CS(=O)(=O)CC32)cn1 |
| InChI | InChI=1S/C19H22N4O3S/c1-14-9-21-16(10-20-14)19(24)23-8-7-22(11-15-5-3-2-4-6-15)17-12-27(25,26)13-18(17)23/h2-6,9-10,17-18H,7-8,11-13H2,1H3 |
| InChIKey | DNNILMASQDECQE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |