C20H30N4O3 — CID 78084131
N-butyl-2-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)cyclohexane-1-carboxamide (PubChem CID 78084131) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-butyl-2-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | N-butyl-2-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 78084131 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-butyl-2-(2,3-dimethyl-4-oxo-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carbonyl)cyclohexane-1-carboxamide |
| SMILES | CCCCNC(=O)C1CCCCC1C(=O)N1Cc2nc(C)n(C)c(=O)c2C1 |
| InChI | InChI=1S/C20H30N4O3/c1-4-5-10-21-18(25)14-8-6-7-9-15(14)20(27)24-11-16-17(12-24)22-13(2)23(3)19(16)26/h14-15H,4-12H2,1-3H3,(H,21,25) |
| InChIKey | YUUJNNWMFHQTIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|