C15H23N3O4S — CID 78084524
(2,5-dimethyl-1,3-oxazol-4-yl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone (PubChem CID 78084524) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2,5-dimethyl-1,3-oxazol-4-yl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone.
| Compound Name | (2,5-dimethyl-1,3-oxazol-4-yl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone |
|---|---|
| PubChem CID | 78084524 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2,5-dimethyl-1,3-oxazol-4-yl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2nc(C)oc2C)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C15H23N3O4S/c1-4-5-17-6-7-18(13-9-23(20,21)8-12(13)17)15(19)14-10(2)22-11(3)16-14/h12-13H,4-9H2,1-3H3 |
| InChIKey | LLKHSAHFBNRXFL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |