C22H22N4O2 — CID 78084845
2-[3-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)phenyl]-4-methylphthalazin-1-one (PubChem CID 78084845) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[3-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)phenyl]-4-methylphthalazin-1-one.
| Compound Name | 2-[3-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)phenyl]-4-methylphthalazin-1-one |
|---|---|
| PubChem CID | 78084845 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[3-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carbonyl)phenyl]-4-methylphthalazin-1-one |
| SMILES | Cc1nn(-c2cccc(C(=O)N3CCC4CNCC43)c2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H22N4O2/c1-14-18-7-2-3-8-19(18)22(28)26(24-14)17-6-4-5-15(11-17)21(27)25-10-9-16-12-23-13-20(16)25/h2-8,11,16,20,23H,9-10,12-13H2,1H3 |
| InChIKey | NUTGQRTYIIOTEG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |