C18H26N2O3S — CID 78086513
(2,5-dimethylphenyl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone (PubChem CID 78086513) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone.
| Compound Name | (2,5-dimethylphenyl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone |
|---|---|
| PubChem CID | 78086513 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2,5-dimethylphenyl)-(6,6-dioxo-1-propyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)methanone |
| SMILES | CCCN1CCN(C(=O)c2cc(C)ccc2C)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C18H26N2O3S/c1-4-7-19-8-9-20(17-12-24(22,23)11-16(17)19)18(21)15-10-13(2)5-6-14(15)3/h5-6,10,16-17H,4,7-9,11-12H2,1-3H3 |
| InChIKey | WYJBUHDRIJUBFG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |