C18H20F2N4O2 — CID 78086979
N-[1-[2-(difluoromethyl)pyrazole-3-carbonyl]-4-(4-methylphenyl)pyrrolidin-3-yl]acetamide (PubChem CID 78086979) has the molecular formula C18H20F2N4O2 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[1-[2-(difluoromethyl)pyrazole-3-carbonyl]-4-(4-methylphenyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[2-(difluoromethyl)pyrazole-3-carbonyl]-4-(4-methylphenyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 78086979 |
| Molecular Formula | C18H20F2N4O2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[1-[2-(difluoromethyl)pyrazole-3-carbonyl]-4-(4-methylphenyl)pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CN(C(=O)c2ccnn2C(F)F)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20F2N4O2/c1-11-3-5-13(6-4-11)14-9-23(10-15(14)22-12(2)25)17(26)16-7-8-21-24(16)18(19)20/h3-8,14-15,18H,9-10H2,1-2H3,(H,22,25) |
| InChIKey | WCZHSMJDTPGCSY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |