About N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide
N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide (PubChem CID 78093814) has the molecular formula C11H21N5
and a molecular weight of 223.32 g/mol. Its IUPAC name is N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide |
| PubChem CID | 78093814 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/C1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C11H21N5/c12-10(14-9-5-1-2-6-9)15-11(13)16-7-3-4-8-16/h9H,1-8H2,(H4,12,13,14,15) |
| InChIKey | SRNYPIRDZVMAFO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide?
The IUPAC name of N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide (CID 78093814) is N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide.
What is the SMILES notation for N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide?
The canonical SMILES for N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide is NC(=N/C(N)=N/C1CCCC1)N1CCCC1.
What is the InChIKey of N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide?
The InChIKey is SRNYPIRDZVMAFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5/c12-10(14-9-5-1-2-6-9)15-11(13)16-7-3-4-8-16/h9H,1-8H2,(H4,12,13,14,15).
What are the key properties of N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide?
N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide has a molecular weight of 223.32 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(N'-cyclopentylcarbamimidoyl)pyrrolidine-1-carboximidamide is sourced from PubChem (CID 78093814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).