About 2,4-dimethylfuro[3,2-c]quinoline
2,4-dimethylfuro[3,2-c]quinoline (PubChem CID 780972) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2,4-dimethylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 2,4-dimethylfuro[3,2-c]quinoline |
| PubChem CID | 780972 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2,4-dimethylfuro[3,2-c]quinoline |
| SMILES | Cc1cc2c(C)nc3ccccc3c2o1 |
| InChI | InChI=1S/C13H11NO/c1-8-7-11-9(2)14-12-6-4-3-5-10(12)13(11)15-8/h3-7H,1-2H3 |
| InChIKey | ZFOCMWZKYXXLBD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylfuro[3,2-c]quinoline?
The IUPAC name of 2,4-dimethylfuro[3,2-c]quinoline (CID 780972) is 2,4-dimethylfuro[3,2-c]quinoline.
What is the SMILES notation for 2,4-dimethylfuro[3,2-c]quinoline?
The canonical SMILES for 2,4-dimethylfuro[3,2-c]quinoline is Cc1cc2c(C)nc3ccccc3c2o1.
What is the InChIKey of 2,4-dimethylfuro[3,2-c]quinoline?
The InChIKey is ZFOCMWZKYXXLBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-8-7-11-9(2)14-12-6-4-3-5-10(12)13(11)15-8/h3-7H,1-2H3.
What are the key properties of 2,4-dimethylfuro[3,2-c]quinoline?
2,4-dimethylfuro[3,2-c]quinoline has a molecular weight of 197.24 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylfuro[3,2-c]quinoline is sourced from PubChem (CID 780972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).