About 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one
14,16-dimethyl-1-oxacyclohexadec-13-en-2-one (PubChem CID 78098447) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one.
Molecular Properties
| Compound Name | 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one |
| PubChem CID | 78098447 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one |
| SMILES | CC1=CCCCCCCCCCCC(=O)OC(C)C1 |
| InChI | InChI=1S/C17H30O2/c1-15-12-10-8-6-4-3-5-7-9-11-13-17(18)19-16(2)14-15/h12,16H,3-11,13-14H2,1-2H3 |
| InChIKey | KUAKFFXWPJREFY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one?
The IUPAC name of 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one (CID 78098447) is 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one.
What is the SMILES notation for 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one?
The canonical SMILES for 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one is CC1=CCCCCCCCCCCC(=O)OC(C)C1.
What is the InChIKey of 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one?
The InChIKey is KUAKFFXWPJREFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-15-12-10-8-6-4-3-5-7-9-11-13-17(18)19-16(2)14-15/h12,16H,3-11,13-14H2,1-2H3.
What are the key properties of 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one?
14,16-dimethyl-1-oxacyclohexadec-13-en-2-one has a molecular weight of 266.42 g/mol, XLogP of 5.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14,16-dimethyl-1-oxacyclohexadec-13-en-2-one is sourced from PubChem (CID 78098447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).