About 1-chloro-4-methylbenzene
1-chloro-4-methylbenzene (PubChem CID 7810) has the molecular formula C7H7Cl
and a molecular weight of 126.59 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene |
| PubChem CID | 7810 |
| Molecular Formula | C7H7Cl |
| Molecular Weight | 126.59 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | 1-chloro-4-methylbenzene |
| SMILES | Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7Cl/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| InChIKey | NPDACUSDTOMAMK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene?
The IUPAC name of 1-chloro-4-methylbenzene (CID 7810) is 1-chloro-4-methylbenzene.
What is the SMILES notation for 1-chloro-4-methylbenzene?
The canonical SMILES for 1-chloro-4-methylbenzene is Cc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-methylbenzene?
The InChIKey is NPDACUSDTOMAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl/c1-6-2-4-7(8)5-3-6/h2-5H,1H3.
What are the key properties of 1-chloro-4-methylbenzene?
1-chloro-4-methylbenzene has a molecular weight of 126.59 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene is sourced from PubChem (CID 7810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).