About 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole
2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole (PubChem CID 781019) has the molecular formula C14H10F2N2S
and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole |
| PubChem CID | 781019 |
| Molecular Formula | C14H10F2N2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole |
| SMILES | Fc1cccc(F)c1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H10F2N2S/c15-10-4-3-5-11(16)9(10)8-19-14-17-12-6-1-2-7-13(12)18-14/h1-7H,8H2,(H,17,18) |
| InChIKey | IXJUKRIVTAHBEU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole?
The IUPAC name of 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole (CID 781019) is 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole.
What is the SMILES notation for 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole?
The canonical SMILES for 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole is Fc1cccc(F)c1CSc1nc2ccccc2[nH]1.
What is the InChIKey of 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole?
The InChIKey is IXJUKRIVTAHBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2S/c15-10-4-3-5-11(16)9(10)8-19-14-17-12-6-1-2-7-13(12)18-14/h1-7H,8H2,(H,17,18).
What are the key properties of 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole?
2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole has a molecular weight of 276.31 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-difluorophenyl)methylsulfanyl]-1H-benzimidazole is sourced from PubChem (CID 781019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).