About 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal
3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal (PubChem CID 78106853) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal |
| PubChem CID | 78106853 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal |
| SMILES | CC=CC=CCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C18H34O2Si/c1-9-10-11-12-13-15(2)17(16(3)14-19)20-21(7,8)18(4,5)6/h9-12,14-17H,13H2,1-8H3 |
| InChIKey | KNYVSJQELFAOSM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal (CID 78106853) is 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal is CC=CC=CCC(C)C(O[Si](C)(C)C(C)(C)C)C(C)C=O.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal?
The InChIKey is KNYVSJQELFAOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2Si/c1-9-10-11-12-13-15(2)17(16(3)14-19)20-21(7,8)18(4,5)6/h9-12,14-17H,13H2,1-8H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal?
3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal has a molecular weight of 310.55 g/mol, XLogP of 5.37, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyldeca-6,8-dienal is sourced from PubChem (CID 78106853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).