About methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate
methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate (PubChem CID 78107131) has the molecular formula C11H16N4O8S
and a molecular weight of 364.34 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate |
| PubChem CID | 78107131 |
| Molecular Formula | C11H16N4O8S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate |
| SMILES | COC(=O)C(CSCC(=O)N1CC([N+](=O)[O-])([N+](=O)[O-])C1)NC(C)=O |
| InChI | InChI=1S/C11H16N4O8S/c1-7(16)12-8(10(18)23-2)3-24-4-9(17)13-5-11(6-13,14(19)20)15(21)22/h8H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | OZYZIIHNRMQIAQ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate?
The IUPAC name of methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate (CID 78107131) is methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate.
What is the SMILES notation for methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate?
The canonical SMILES for methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate is COC(=O)C(CSCC(=O)N1CC([N+](=O)[O-])([N+](=O)[O-])C1)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate?
The InChIKey is OZYZIIHNRMQIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O8S/c1-7(16)12-8(10(18)23-2)3-24-4-9(17)13-5-11(6-13,14(19)20)15(21)22/h8H,3-6H2,1-2H3,(H,12,16).
What are the key properties of methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate?
methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate has a molecular weight of 364.34 g/mol, XLogP of -1.51, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-[2-(3,3-dinitroazetidin-1-yl)-2-oxoethyl]sulfanylpropanoate is sourced from PubChem (CID 78107131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).