About 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine
2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine (PubChem CID 781073) has the molecular formula C18H18N4
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine |
| PubChem CID | 781073 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine |
| SMILES | CN(C)c1nc(-c2ccccc2)c(N)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H18N4/c1-22(2)18-20-16(13-9-5-3-6-10-13)15(19)17(21-18)14-11-7-4-8-12-14/h3-12H,19H2,1-2H3 |
| InChIKey | XGXDOILAGPABMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine?
The IUPAC name of 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine (CID 781073) is 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine.
What is the SMILES notation for 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine?
The canonical SMILES for 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine is CN(C)c1nc(-c2ccccc2)c(N)c(-c2ccccc2)n1.
What is the InChIKey of 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine?
The InChIKey is XGXDOILAGPABMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4/c1-22(2)18-20-16(13-9-5-3-6-10-13)15(19)17(21-18)14-11-7-4-8-12-14/h3-12H,19H2,1-2H3.
What are the key properties of 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine?
2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine has a molecular weight of 290.37 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethyl-4,6-diphenylpyrimidine-2,5-diamine is sourced from PubChem (CID 781073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).