C21H22Cl2F3N3O2S — CID 78107366
N-[2-[(3,5-dichlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 78107366) has the molecular formula C21H22Cl2F3N3O2S and a molecular weight of 508.39 g/mol. Its IUPAC name is N-[2-[(3,5-dichlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[(3,5-dichlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78107366 |
| Molecular Formula | C21H22Cl2F3N3O2S |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[2-[(3,5-dichlorophenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC2CN(Cc3cc(Cl)cc(Cl)c3)CCN2C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22Cl2F3N3O2S/c22-16-6-14(7-17(23)9-16)11-28-4-5-29-12-18(10-19(29)13-28)27-32(30,31)20-3-1-2-15(8-20)21(24,25)26/h1-3,6-9,18-19,27H,4-5,10-13H2 |
| InChIKey | OBAPLGCNZWRTMN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |