C13H24O — CID 78109943
(4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl)methanol (PubChem CID 78109943) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl)methanol.
| Compound Name | (4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl)methanol |
|---|---|
| PubChem CID | 78109943 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-2-yl)methanol |
| SMILES | CC1(C)CCCC2(C)CC(CO)CC12 |
| InChI | InChI=1S/C13H24O/c1-12(2)5-4-6-13(3)8-10(9-14)7-11(12)13/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | KFJWFTTXPFDTPL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |