C19H23N5O2 — CID 78110338
1-[3-(3-methoxypropyl)-2H-pyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea (PubChem CID 78110338) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 1-[3-(3-methoxypropyl)-2H-pyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[3-(3-methoxypropyl)-2H-pyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 78110338 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[3-(3-methoxypropyl)-2H-pyrazolo[4,3-c]pyridin-6-yl]-3-(1-phenylethyl)urea |
| SMILES | COCCCc1[nH]nc2cc(NC(=O)NC(C)c3ccccc3)ncc12 |
| InChI | InChI=1S/C19H23N5O2/c1-13(14-7-4-3-5-8-14)21-19(25)22-18-11-17-15(12-20-18)16(23-24-17)9-6-10-26-2/h3-5,7-8,11-13H,6,9-10H2,1-2H3,(H,23,24)(H2,20,21,22,25) |
| InChIKey | YACZKRXTTLTDQA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|