About 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol
2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol (PubChem CID 78110543) has the molecular formula C19H13FO5S
and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol |
| PubChem CID | 78110543 |
| Molecular Formula | C19H13FO5S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol |
| SMILES | O=S1(=O)OC(c2ccc(O)cc2)(c2ccc(O)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C19H13FO5S/c20-16-11-13(7-10-17(16)22)19(12-5-8-14(21)9-6-12)15-3-1-2-4-18(15)26(23,24)25-19/h1-11,21-22H |
| InChIKey | JAYUFGYSXFXOSO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_sulfite_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol?
The IUPAC name of 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol (CID 78110543) is 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol.
What is the SMILES notation for 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol?
The canonical SMILES for 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol is O=S1(=O)OC(c2ccc(O)cc2)(c2ccc(O)c(F)c2)c2ccccc21.
What is the InChIKey of 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol?
The InChIKey is JAYUFGYSXFXOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13FO5S/c20-16-11-13(7-10-17(16)22)19(12-5-8-14(21)9-6-12)15-3-1-2-4-18(15)26(23,24)25-19/h1-11,21-22H.
What are the key properties of 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol?
2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol has a molecular weight of 372.37 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-[3-(4-hydroxyphenyl)-1,1-dioxo-2,1λ6-benzoxathiol-3-yl]phenol is sourced from PubChem (CID 78110543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).