C19H20N4O3 — CID 78113926
11-[(2,4-dimethoxyphenyl)methyl]-13-methyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one (PubChem CID 78113926) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 11-[(2,4-dimethoxyphenyl)methyl]-13-methyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one.
| Compound Name | 11-[(2,4-dimethoxyphenyl)methyl]-13-methyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
|---|---|
| PubChem CID | 78113926 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 11-[(2,4-dimethoxyphenyl)methyl]-13-methyl-1,3,8,11-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-10-one |
| SMILES | COc1ccc(CN2CC(C)n3c(nc4cccnc43)C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-12-10-22(11-13-6-7-14(25-2)9-16(13)26-3)19(24)18-21-15-5-4-8-20-17(15)23(12)18/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | BMVSMKIQUFABGQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |