C19H14BCl2F4NO3 — CID 78116773
5-(3,5-dichloro-4-fluorophenyl)-3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 78116773) has the molecular formula C19H14BCl2F4NO3 and a molecular weight of 462.04 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-fluorophenyl)-3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole.
| Compound Name | 5-(3,5-dichloro-4-fluorophenyl)-3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 78116773 |
| Molecular Formula | C19H14BCl2F4NO3 |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 5-(3,5-dichloro-4-fluorophenyl)-3-(1-hydroxy-3,3-dimethyl-2,1-benzoxaborol-5-yl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | CC1(C)OB(O)c2ccc(C3=NOC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc21 |
| InChI | InChI=1S/C19H14BCl2F4NO3/c1-17(2)11-5-9(3-4-12(11)20(28)29-17)15-8-18(30-27-15,19(24,25)26)10-6-13(21)16(23)14(22)7-10/h3-7,28H,8H2,1-2H3 |
| InChIKey | QKEXQELISPDIMT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|