C24H26ClF3N2O3 — CID 78118527
2-[4-(4-chlorophenyl)-2,3,6-trimethyl-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 78118527) has the molecular formula C24H26ClF3N2O3 and a molecular weight of 482.93 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2,3,6-trimethyl-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)-2,3,6-trimethyl-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 78118527 |
| Molecular Formula | C24H26ClF3N2O3 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2,3,6-trimethyl-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridin-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1nc2c(c(C)c(C)n2CC(F)(F)F)c(-c2ccc(Cl)cc2)c1C(OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H26ClF3N2O3/c1-12-14(3)30(11-24(26,27)28)21-17(12)19(15-7-9-16(25)10-8-15)18(13(2)29-21)20(22(31)32)33-23(4,5)6/h7-10,20H,11H2,1-6H3,(H,31,32) |
| InChIKey | MECAETZJAZWZQF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |