C27H28FN3O6 — CID 78121968
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-(7-fluoro-2-methoxyquinolin-8-yl)-2-hydroxyethyl]-4,4a,5,6,8,8a-hexahydropyrido[4,3-e][1,3]oxazin-2-one (PubChem CID 78121968) has the molecular formula C27H28FN3O6 and a molecular weight of 509.53 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-(7-fluoro-2-methoxyquinolin-8-yl)-2-hydroxyethyl]-4,4a,5,6,8,8a-hexahydropyrido[4,3-e][1,3]oxazin-2-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-(7-fluoro-2-methoxyquinolin-8-yl)-2-hydroxyethyl]-4,4a,5,6,8,8a-hexahydropyrido[4,3-e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 78121968 |
| Molecular Formula | C27H28FN3O6 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-(7-fluoro-2-methoxyquinolin-8-yl)-2-hydroxyethyl]-4,4a,5,6,8,8a-hexahydropyrido[4,3-e][1,3]oxazin-2-one |
| SMILES | COc1ccc2ccc(F)c(C(O)CN3CCC4CN(c5ccc6c(c5)OCCO6)C(=O)OC4C3)c2n1 |
| InChI | InChI=1S/C27H28FN3O6/c1-34-24-7-3-16-2-5-19(28)25(26(16)29-24)20(32)14-30-9-8-17-13-31(27(33)37-23(17)15-30)18-4-6-21-22(12-18)36-11-10-35-21/h2-7,12,17,20,23,32H,8-11,13-15H2,1H3 |
| InChIKey | APLZRENRXBUHEJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |