C23H32O4 — CID 78123649
4-[2-(3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)ethenyl]-2H-furan-5-one (PubChem CID 78123649) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-[2-(3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)ethenyl]-2H-furan-5-one.
| Compound Name | 4-[2-(3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)ethenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 78123649 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 4-[2-(3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl)ethenyl]-2H-furan-5-one |
| SMILES | C=C1CCC2C3(C)COC(C)(C)OC3CCC2(C)C1C=CC1=CCOC1=O |
| InChI | InChI=1S/C23H32O4/c1-15-6-9-18-22(4,17(15)8-7-16-11-13-25-20(16)24)12-10-19-23(18,5)14-26-21(2,3)27-19/h7-8,11,17-19H,1,6,9-10,12-14H2,2-5H3 |
| InChIKey | AYAPNFCWKWGRDX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|