C18H18N2O2 — CID 781306
2-(2-methoxyphenyl)-5,5-dimethyl-1-oxido-4-phenylimidazol-1-ium (PubChem CID 781306) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-5,5-dimethyl-1-oxido-4-phenylimidazol-1-ium.
| Compound Name | 2-(2-methoxyphenyl)-5,5-dimethyl-1-oxido-4-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 781306 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-5,5-dimethyl-1-oxido-4-phenylimidazol-1-ium |
| SMILES | COc1ccccc1C1=[N+]([O-])C(C)(C)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C18H18N2O2/c1-18(2)16(13-9-5-4-6-10-13)19-17(20(18)21)14-11-7-8-12-15(14)22-3/h4-12H,1-3H3 |
| InChIKey | AYALQISXPQZMQW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|