C20H24BN3O3 — CID 78135033
[2-(3-ethylphenyl)-1-(3-indazol-1-ylpropanoylamino)ethyl]boronic acid (PubChem CID 78135033) has the molecular formula C20H24BN3O3 and a molecular weight of 365.24 g/mol. Its IUPAC name is [2-(3-ethylphenyl)-1-(3-indazol-1-ylpropanoylamino)ethyl]boronic acid.
| Compound Name | [2-(3-ethylphenyl)-1-(3-indazol-1-ylpropanoylamino)ethyl]boronic acid |
|---|---|
| PubChem CID | 78135033 |
| Molecular Formula | C20H24BN3O3 |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [2-(3-ethylphenyl)-1-(3-indazol-1-ylpropanoylamino)ethyl]boronic acid |
| SMILES | CCc1cccc(CC(NC(=O)CCn2ncc3ccccc32)B(O)O)c1 |
| InChI | InChI=1S/C20H24BN3O3/c1-2-15-6-5-7-16(12-15)13-19(21(26)27)23-20(25)10-11-24-18-9-4-3-8-17(18)14-22-24/h3-9,12,14,19,26-27H,2,10-11,13H2,1H3,(H,23,25) |
| InChIKey | AQKQGNJXWQHGPQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|