C19H19BF3N3O3 — CID 78135095
[1-[3-(benzimidazol-1-yl)propanoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]boronic acid (PubChem CID 78135095) has the molecular formula C19H19BF3N3O3 and a molecular weight of 405.19 g/mol. Its IUPAC name is [1-[3-(benzimidazol-1-yl)propanoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]boronic acid.
| Compound Name | [1-[3-(benzimidazol-1-yl)propanoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]boronic acid |
|---|---|
| PubChem CID | 78135095 |
| Molecular Formula | C19H19BF3N3O3 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [1-[3-(benzimidazol-1-yl)propanoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]boronic acid |
| SMILES | O=C(CCn1cnc2ccccc21)NC(Cc1cccc(C(F)(F)F)c1)B(O)O |
| InChI | InChI=1S/C19H19BF3N3O3/c21-19(22,23)14-5-3-4-13(10-14)11-17(20(28)29)25-18(27)8-9-26-12-24-15-6-1-2-7-16(15)26/h1-7,10,12,17,28-29H,8-9,11H2,(H,25,27) |
| InChIKey | HKNZYBCEIUHVFJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|