C31H34N2O6S — CID 78137166
2-[3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-(2-methyl-6-sulfamoylhexan-2-yl)oxyacetic acid (PubChem CID 78137166) has the molecular formula C31H34N2O6S and a molecular weight of 562.69 g/mol. Its IUPAC name is 2-[3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-(2-methyl-6-sulfamoylhexan-2-yl)oxyacetic acid.
| Compound Name | 2-[3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-(2-methyl-6-sulfamoylhexan-2-yl)oxyacetic acid |
|---|---|
| PubChem CID | 78137166 |
| Molecular Formula | C31H34N2O6S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-(2-methyl-6-sulfamoylhexan-2-yl)oxyacetic acid |
| SMILES | Cc1cc2ccccc2c(-c2ccc3c4c(ccnc24)CCO3)c1C(OC(C)(C)CCCCS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C31H34N2O6S/c1-19-18-21-8-4-5-9-22(21)27(23-10-11-24-26-20(13-16-38-24)12-15-33-28(23)26)25(19)29(30(34)35)39-31(2,3)14-6-7-17-40(32,36)37/h4-5,8-12,15,18,29H,6-7,13-14,16-17H2,1-3H3,(H,34,35)(H2,32,36,37) |
| InChIKey | CQSYGDRRXSICLM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|