C15H19N5O — CID 78137542
6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one (PubChem CID 78137542) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one.
| Compound Name | 6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 78137542 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-1,2,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-3-one |
| SMILES | CN(c1ncnc2[nH]ccc12)C1CC2CNC(=O)CC2C1 |
| InChI | InChI=1S/C15H19N5O/c1-20(15-12-2-3-16-14(12)18-8-19-15)11-4-9-6-13(21)17-7-10(9)5-11/h2-3,8-11H,4-7H2,1H3,(H,17,21)(H,16,18,19) |
| InChIKey | PJQRHTCLLFABDO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |