About 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one
2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one (PubChem CID 78143475) has the molecular formula C24H21Br2NO2
and a molecular weight of 515.25 g/mol. Its IUPAC name is 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one |
| PubChem CID | 78143475 |
| Molecular Formula | C24H21Br2NO2 |
| Molecular Weight | 515.25 g/mol |
| Exact Mass | 512.99 |
| IUPAC Name | 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one |
| SMILES | CN1C(=O)C(Cc2ccccc2)OC(c2ccc(Br)cc2)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H21Br2NO2/c1-27-22(17-7-11-19(25)12-8-17)23(18-9-13-20(26)14-10-18)29-21(24(27)28)15-16-5-3-2-4-6-16/h2-14,21-23H,15H2,1H3 |
| InChIKey | YYVYIVSNIAMIER-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.25 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one?
The IUPAC name of 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one (CID 78143475) is 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one.
What is the SMILES notation for 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one?
The canonical SMILES for 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one is CN1C(=O)C(Cc2ccccc2)OC(c2ccc(Br)cc2)C1c1ccc(Br)cc1.
What is the InChIKey of 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one?
The InChIKey is YYVYIVSNIAMIER-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Br2NO2/c1-27-22(17-7-11-19(25)12-8-17)23(18-9-13-20(26)14-10-18)29-21(24(27)28)15-16-5-3-2-4-6-16/h2-14,21-23H,15H2,1H3.
What are the key properties of 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one?
2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one has a molecular weight of 515.25 g/mol, XLogP of 6.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5,6-bis(4-bromophenyl)-4-methylmorpholin-3-one is sourced from PubChem (CID 78143475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).