C18H15NO4 — CID 7814374
[(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 7814374) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7814374 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(2S)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccco1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H15NO4/c1-12(23-18(21)16-7-4-10-22-16)17(20)19-15-9-8-13-5-2-3-6-14(13)11-15/h2-12H,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | GBRUNYGNOOGMQI-LBPRGKRZSA-N |
| XLogP | 3.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |