About 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one
5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one (PubChem CID 78144712) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one.
Molecular Properties
| Compound Name | 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one |
| PubChem CID | 78144712 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one |
| SMILES | CC=CC=C1C=CC2=C1C(=O)CCN2 |
| InChI | InChI=1S/C12H13NO/c1-2-3-4-9-5-6-10-12(9)11(14)7-8-13-10/h2-6,13H,7-8H2,1H3 |
| InChIKey | HKLWUXDZILHGOB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The IUPAC name of 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one (CID 78144712) is 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one.
What is the SMILES notation for 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The canonical SMILES for 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one is CC=CC=C1C=CC2=C1C(=O)CCN2.
What is the InChIKey of 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
The InChIKey is HKLWUXDZILHGOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-2-3-4-9-5-6-10-12(9)11(14)7-8-13-10/h2-6,13H,7-8H2,1H3.
What are the key properties of 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one?
5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one has a molecular weight of 187.24 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-2-enylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-4-one is sourced from PubChem (CID 78144712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).