C23H23ClN8O2 — CID 78145194
N-[5-[6-amino-7-(4-chlorophenyl)-8-oxopurin-9-yl]-2-pyridinyl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 78145194) has the molecular formula C23H23ClN8O2 and a molecular weight of 478.94 g/mol. Its IUPAC name is N-[5-[6-amino-7-(4-chlorophenyl)-8-oxopurin-9-yl]-2-pyridinyl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | N-[5-[6-amino-7-(4-chlorophenyl)-8-oxopurin-9-yl]-2-pyridinyl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 78145194 |
| Molecular Formula | C23H23ClN8O2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[5-[6-amino-7-(4-chlorophenyl)-8-oxopurin-9-yl]-2-pyridinyl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | CN(C)CC=CC(=O)N(C)c1ccc(-n2c(=O)n(-c3ccc(Cl)cc3)c3c(N)ncnc32)cn1 |
| InChI | InChI=1S/C23H23ClN8O2/c1-29(2)12-4-5-19(33)30(3)18-11-10-17(13-26-18)32-22-20(21(25)27-14-28-22)31(23(32)34)16-8-6-15(24)7-9-16/h4-11,13-14H,12H2,1-3H3,(H2,25,27,28) |
| InChIKey | CMBUKMHAHJNPKU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|