About N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine
N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine (PubChem CID 78146354) has the molecular formula C12H8F3NO
and a molecular weight of 239.20 g/mol. Its IUPAC name is N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine |
| PubChem CID | 78146354 |
| Molecular Formula | C12H8F3NO |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine |
| SMILES | ON=C(c1ccc2cccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C12H8F3NO/c13-12(14,15)11(16-17)10-7-6-8-4-2-1-3-5-9(8)10/h1-7,17H |
| InChIKey | NDMYRYUNYRRRGK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine?
The IUPAC name of N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine (CID 78146354) is N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine.
What is the SMILES notation for N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine?
The canonical SMILES for N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine is ON=C(c1ccc2cccccc1-2)C(F)(F)F.
What is the InChIKey of N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine?
The InChIKey is NDMYRYUNYRRRGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO/c13-12(14,15)11(16-17)10-7-6-8-4-2-1-3-5-9(8)10/h1-7,17H.
What are the key properties of N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine?
N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine has a molecular weight of 239.20 g/mol, XLogP of 3.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-azulen-1-yl-2,2,2-trifluoroethylidene)hydroxylamine is sourced from PubChem (CID 78146354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).