C15H14ClNO4 — CID 7814639
[2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 7814639) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7814639 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO4/c1-10(11-4-6-12(16)7-5-11)17-14(18)9-21-15(19)13-3-2-8-20-13/h2-8,10H,9H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | MPRWEQBQIZLHSD-JTQLQIEISA-N |
| XLogP | 2.97 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |