C34H40O15 — CID 78146504
[3-acetyloxy-2-(1,3,4,7,9-pentaacetyloxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)propyl] acetate (PubChem CID 78146504) has the molecular formula C34H40O15 and a molecular weight of 688.68 g/mol. Its IUPAC name is [3-acetyloxy-2-(1,3,4,7,9-pentaacetyloxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)propyl] acetate.
| Compound Name | [3-acetyloxy-2-(1,3,4,7,9-pentaacetyloxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)propyl] acetate |
|---|---|
| PubChem CID | 78146504 |
| Molecular Formula | C34H40O15 |
| Molecular Weight | 688.68 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | [3-acetyloxy-2-(1,3,4,7,9-pentaacetyloxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)propyl] acetate |
| SMILES | CC(=O)OCC(COC(C)=O)c1c(OC(C)=O)c(OC(C)=O)c2c(c1OC(C)=O)C(=O)C(OC(C)=O)=C1C2(C)CCC(OC(C)=O)C1(C)C |
| InChI | InChI=1S/C34H40O15/c1-15(35)43-13-22(14-44-16(2)36)24-28(46-18(4)38)25-26(30(48-20(6)40)29(24)47-19(5)39)34(10)12-11-23(45-17(3)37)33(8,9)32(34)31(27(25)42)49-21(7)41/h22-23H,11-14H2,1-10H3 |
| InChIKey | YOWVHMRKWREXPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 201.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|