C26H38N6O2 — CID 78147350
2-[1-[[4-(diethylamino)phenyl]methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 78147350) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-[1-[[4-(diethylamino)phenyl]methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[1-[[4-(diethylamino)phenyl]methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 78147350 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 2-[1-[[4-(diethylamino)phenyl]methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCN(CC)c1ccc(CN2CC(C)C(C3NC(=O)c4cnc(C5CCOCC5)n4N3)C2)cc1 |
| InChI | InChI=1S/C26H38N6O2/c1-4-31(5-2)21-8-6-19(7-9-21)16-30-15-18(3)22(17-30)24-28-26(33)23-14-27-25(32(23)29-24)20-10-12-34-13-11-20/h6-9,14,18,20,22,24,29H,4-5,10-13,15-17H2,1-3H3,(H,28,33) |
| InChIKey | LIKYUAZNJJLLSK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|