C22H27F2N5O2 — CID 78147725
2-[1-[(3,4-difluorophenyl)methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 78147725) has the molecular formula C22H27F2N5O2 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[1-[(3,4-difluorophenyl)methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[1-[(3,4-difluorophenyl)methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 78147725 |
| Molecular Formula | C22H27F2N5O2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[1-[(3,4-difluorophenyl)methyl]-4-methylpyrrolidin-3-yl]-7-(oxan-4-yl)-2,3-dihydro-1H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CC1CN(Cc2ccc(F)c(F)c2)CC1C1NC(=O)c2cnc(C3CCOCC3)n2N1 |
| InChI | InChI=1S/C22H27F2N5O2/c1-13-10-28(11-14-2-3-17(23)18(24)8-14)12-16(13)20-26-22(30)19-9-25-21(29(19)27-20)15-4-6-31-7-5-15/h2-3,8-9,13,15-16,20,27H,4-7,10-12H2,1H3,(H,26,30) |
| InChIKey | CWYZEYZWBKFVMC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |