C18H26N2O5 — CID 78150368
N-[4-[3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-2-methoxyacetamide (PubChem CID 78150368) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[4-[3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-[3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 78150368 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[4-[3-(hydroxymethyl)-4-(2-methylpropyl)-5-oxomorpholin-2-yl]phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(C2OCC(=O)N(CC(C)C)C2CO)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-12(2)8-20-15(9-21)18(25-11-17(20)23)13-4-6-14(7-5-13)19-16(22)10-24-3/h4-7,12,15,18,21H,8-11H2,1-3H3,(H,19,22) |
| InChIKey | HWIHAHBRQGXSLC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |