C13H8F2N4S — CID 781504
2,6-diamino-4-(2,5-difluorophenyl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 781504) has the molecular formula C13H8F2N4S and a molecular weight of 290.30 g/mol. Its IUPAC name is 2,6-diamino-4-(2,5-difluorophenyl)-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-(2,5-difluorophenyl)-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 781504 |
| Molecular Formula | C13H8F2N4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2,6-diamino-4-(2,5-difluorophenyl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | N#CC1=C(N)SC(N)=C(C#N)C1c1cc(F)ccc1F |
| InChI | InChI=1S/C13H8F2N4S/c14-6-1-2-10(15)7(3-6)11-8(4-16)12(18)20-13(19)9(11)5-17/h1-3,11H,18-19H2 |
| InChIKey | GTMAOYXRWPRMAY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|