C24H26N4O3S — CID 78151146
4-[(1-methylindol-3-yl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine (PubChem CID 78151146) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-[(1-methylindol-3-yl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine.
| Compound Name | 4-[(1-methylindol-3-yl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine |
|---|---|
| PubChem CID | 78151146 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 4-[(1-methylindol-3-yl)methyl]-3-[5-(4-methylsulfonylphenyl)-1H-imidazol-2-yl]morpholine |
| SMILES | Cn1cc(CN2CCOCC2c2ncc(-c3ccc(S(C)(=O)=O)cc3)[nH]2)c2ccccc21 |
| InChI | InChI=1S/C24H26N4O3S/c1-27-14-18(20-5-3-4-6-22(20)27)15-28-11-12-31-16-23(28)24-25-13-21(26-24)17-7-9-19(10-8-17)32(2,29)30/h3-10,13-14,23H,11-12,15-16H2,1-2H3,(H,25,26) |
| InChIKey | SCQAMDWWIZFLDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |