About 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol
2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol (PubChem CID 78151161) has the molecular formula C20H19F2N3O2
and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol |
| PubChem CID | 78151161 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol |
| SMILES | Oc1ccccc1CN1CCOCC1c1ncc(-c2ccc(F)cc2F)[nH]1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-14-5-6-15(16(22)9-14)17-10-23-20(24-17)18-12-27-8-7-25(18)11-13-3-1-2-4-19(13)26/h1-6,9-10,18,26H,7-8,11-12H2,(H,23,24) |
| InChIKey | IEGRVGOWNHVUKZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol?
The IUPAC name of 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol (CID 78151161) is 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol.
What is the SMILES notation for 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol?
The canonical SMILES for 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol is Oc1ccccc1CN1CCOCC1c1ncc(-c2ccc(F)cc2F)[nH]1.
What is the InChIKey of 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol?
The InChIKey is IEGRVGOWNHVUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2N3O2/c21-14-5-6-15(16(22)9-14)17-10-23-20(24-17)18-12-27-8-7-25(18)11-13-3-1-2-4-19(13)26/h1-6,9-10,18,26H,7-8,11-12H2,(H,23,24).
What are the key properties of 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol?
2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol has a molecular weight of 371.39 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[5-(2,4-difluorophenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]phenol is sourced from PubChem (CID 78151161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).