C23H28N4O2 — CID 78151248
4-[[3-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]-N,N-dimethylaniline (PubChem CID 78151248) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[[3-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[3-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 78151248 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[[3-[5-(3-methoxyphenyl)-1H-imidazol-2-yl]morpholin-4-yl]methyl]-N,N-dimethylaniline |
| SMILES | COc1cccc(-c2cnc(C3COCCN3Cc3ccc(N(C)C)cc3)[nH]2)c1 |
| InChI | InChI=1S/C23H28N4O2/c1-26(2)19-9-7-17(8-10-19)15-27-11-12-29-16-22(27)23-24-14-21(25-23)18-5-4-6-20(13-18)28-3/h4-10,13-14,22H,11-12,15-16H2,1-3H3,(H,24,25) |
| InChIKey | JFZSAUAPWJJNSW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|