About [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate
[(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 7815167) has the molecular formula C24H20O5
and a molecular weight of 388.42 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate.
Molecular Properties
| Compound Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| PubChem CID | 7815167 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | COc1ccc(C(=O)[C@@H](C)OC(=O)c2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20O5/c1-16(22(25)18-12-14-19(28-2)15-13-18)29-24(27)21-11-7-6-10-20(21)23(26)17-8-4-3-5-9-17/h3-16H,1-2H3/t16-/m1/s1 |
| InChIKey | IGDIDTMKMWDQQY-MRXNPFEDSA-N |
| XLogP | 4.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate?
The IUPAC name of [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate (CID 7815167) is [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate.
What is the SMILES notation for [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate?
The canonical SMILES for [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate is COc1ccc(C(=O)[C@@H](C)OC(=O)c2ccccc2C(=O)c2ccccc2)cc1.
What is the InChIKey of [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate?
The InChIKey is IGDIDTMKMWDQQY-MRXNPFEDSA-N. The full InChI is InChI=1S/C24H20O5/c1-16(22(25)18-12-14-19(28-2)15-13-18)29-24(27)21-11-7-6-10-20(21)23(26)17-8-4-3-5-9-17/h3-16H,1-2H3/t16-/m1/s1.
What are the key properties of [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate?
[(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate has a molecular weight of 388.42 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-benzoylbenzoate is sourced from PubChem (CID 7815167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).