About N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide
N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide (PubChem CID 78152122) has the molecular formula C18H15BrF2N2OS2
and a molecular weight of 457.37 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide |
| PubChem CID | 78152122 |
| Molecular Formula | C18H15BrF2N2OS2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide |
| SMILES | O=C(NC(CSc1nc2ccccc2s1)Cc1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C18H15BrF2N2OS2/c19-18(20,21)16(24)22-13(10-12-6-2-1-3-7-12)11-25-17-23-14-8-4-5-9-15(14)26-17/h1-9,13H,10-11H2,(H,22,24) |
| InChIKey | OCWYCBWMAGSEIW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide?
The IUPAC name of N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide (CID 78152122) is N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide.
What is the SMILES notation for N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide?
The canonical SMILES for N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide is O=C(NC(CSc1nc2ccccc2s1)Cc1ccccc1)C(F)(F)Br.
What is the InChIKey of N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide?
The InChIKey is OCWYCBWMAGSEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrF2N2OS2/c19-18(20,21)16(24)22-13(10-12-6-2-1-3-7-12)11-25-17-23-14-8-4-5-9-15(14)26-17/h1-9,13H,10-11H2,(H,22,24).
What are the key properties of N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide?
N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide has a molecular weight of 457.37 g/mol, XLogP of 5.10, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-benzothiazol-2-ylsulfanyl)-3-phenylpropan-2-yl]-2-bromo-2,2-difluoroacetamide is sourced from PubChem (CID 78152122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).