C20H17F2N7O2 — CID 78153609
1-[1-[3-[(5,7-difluoroquinolin-6-yl)-hydroxymethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1-methylurea (PubChem CID 78153609) has the molecular formula C20H17F2N7O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-[1-[3-[(5,7-difluoroquinolin-6-yl)-hydroxymethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1-methylurea.
| Compound Name | 1-[1-[3-[(5,7-difluoroquinolin-6-yl)-hydroxymethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1-methylurea |
|---|---|
| PubChem CID | 78153609 |
| Molecular Formula | C20H17F2N7O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-[1-[3-[(5,7-difluoroquinolin-6-yl)-hydroxymethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]-1-methylurea |
| SMILES | CC(=NN(C)C(N)=O)c1ccc2ncc(C(O)c3c(F)cc4ncccc4c3F)n2n1 |
| InChI | InChI=1S/C20H17F2N7O2/c1-10(26-28(2)20(23)31)13-5-6-16-25-9-15(29(16)27-13)19(30)17-12(21)8-14-11(18(17)22)4-3-7-24-14/h3-9,19,30H,1-2H3,(H2,23,31) |
| InChIKey | GVZDSDIQCOOLMF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|