C14H22N2 — CID 78154
Cyclododecapyrimidine, 5,6,7,8,9,10,11,12,13,14-decahydro- (PubChem CID 78154) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[d]pyrimidine.
| Compound Name | Cyclododecapyrimidine, 5,6,7,8,9,10,11,12,13,14-decahydro- |
|---|---|
| PubChem CID | 78154 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5,6,7,8,9,10,11,12,13,14-decahydrocyclododeca[d]pyrimidine |
| SMILES | C1CCCCCC2=NC=NC=C2CCCC1 |
| InChI | InChI=1S/C14H22N2/c1-2-4-6-8-10-14-13(9-7-5-3-1)11-15-12-16-14/h11-12H,1-10H2 |
| InChIKey | CXLMQNDFKHWBOQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 182 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |