C23H27FN4O2 — CID 78154014
2-[3-(4-fluorophenyl)-5-methylpyrazolidin-4-yl]-N-[2-(5-methoxyindol-1-yl)ethyl]acetamide (PubChem CID 78154014) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-5-methylpyrazolidin-4-yl]-N-[2-(5-methoxyindol-1-yl)ethyl]acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-5-methylpyrazolidin-4-yl]-N-[2-(5-methoxyindol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 78154014 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-5-methylpyrazolidin-4-yl]-N-[2-(5-methoxyindol-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2c(ccn2CCNC(=O)CC2C(C)NNC2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H27FN4O2/c1-15-20(23(27-26-15)16-3-5-18(24)6-4-16)14-22(29)25-10-12-28-11-9-17-13-19(30-2)7-8-21(17)28/h3-9,11,13,15,20,23,26-27H,10,12,14H2,1-2H3,(H,25,29) |
| InChIKey | ADACMNPMKNXOCZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |