C33H47NO3 — CID 78155827
3-[[3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-7-methylidene-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-8-yl]methyl]-1-(2-methylbut-3-en-2-yl)-3H-indol-2-one (PubChem CID 78155827) has the molecular formula C33H47NO3 and a molecular weight of 505.74 g/mol. Its IUPAC name is 3-[[3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-7-methylidene-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-8-yl]methyl]-1-(2-methylbut-3-en-2-yl)-3H-indol-2-one.
| Compound Name | 3-[[3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-7-methylidene-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-8-yl]methyl]-1-(2-methylbut-3-en-2-yl)-3H-indol-2-one |
|---|---|
| PubChem CID | 78155827 |
| Molecular Formula | C33H47NO3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | 3-[[3-(2-hydroxypropan-2-yl)-6a,10b-dimethyl-7-methylidene-1,2,3,4a,5,6,8,9,10,10a-decahydrobenzo[f]chromen-8-yl]methyl]-1-(2-methylbut-3-en-2-yl)-3H-indol-2-one |
| SMILES | C=CC(C)(C)N1C(=O)C(CC2CCC3C(C)(CCC4OC(C(C)(C)O)CCC43C)C2=C)c2ccccc21 |
| InChI | InChI=1S/C33H47NO3/c1-9-30(3,4)34-25-13-11-10-12-23(25)24(29(34)35)20-22-14-15-26-32(7,21(22)2)18-17-28-33(26,8)19-16-27(37-28)31(5,6)36/h9-13,22,24,26-28,36H,1-2,14-20H2,3-8H3 |
| InChIKey | QWTTYYHQARGNPV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|