C35H56O11 — CID 78155989
4,4',6,12,17,17-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,2'-oxolane]-3,3',4',14-tetrol (PubChem CID 78155989) has the molecular formula C35H56O11 and a molecular weight of 652.82 g/mol. Its IUPAC name is 4,4',6,12,17,17-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,2'-oxolane]-3,3',4',14-tetrol.
| Compound Name | 4,4',6,12,17,17-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,2'-oxolane]-3,3',4',14-tetrol |
|---|---|
| PubChem CID | 78155989 |
| Molecular Formula | C35H56O11 |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | 4,4',6,12,17,17-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyspiro[9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-8,2'-oxolane]-3,3',4',14-tetrol |
| SMILES | CC1CC2(OCC(C)(O)C2O)OC2CC3(C)C4C(O)CC5C(C)(C)C(OC6OCC(O)C(O)C6O)CCC56CC46CC(O)C3(C)C12 |
| InChI | InChI=1S/C35H56O11/c1-16-10-35(28(41)31(5,42)15-44-35)46-19-11-30(4)26-17(36)9-20-29(2,3)22(45-27-25(40)24(39)18(37)13-43-27)7-8-33(20)14-34(26,33)12-21(38)32(30,6)23(16)19/h16-28,36-42H,7-15H2,1-6H3 |
| InChIKey | BURFZMFSWQCUCA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|